C22H25ClN2O5 — CID 126317717
N-[(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 126317717) has the molecular formula C22H25ClN2O5 and a molecular weight of 432.90 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126317717 |
| Molecular Formula | C22H25ClN2O5 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[(E)-(3-chloro-5-methoxy-4-propoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCCC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H25ClN2O5/c1-5-9-29-18-8-7-16(13-19(18)27-3)22(26)25-24-14-15-11-17(23)21(30-10-6-2)20(12-15)28-4/h5,7-8,11-14H,1,6,9-10H2,2-4H3,(H,25,26)/b24-14+ |
| InChIKey | ASCXFVISZSLQIW-ZVHZXABRSA-N |
| XLogP | 4.47 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|