C21H24ClN3O6 — CID 126343051
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-propoxybenzamide (PubChem CID 126343051) has the molecular formula C21H24ClN3O6 and a molecular weight of 449.89 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-propoxybenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 126343051 |
| Molecular Formula | C21H24ClN3O6 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCC(N)=O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H24ClN3O6/c1-4-7-30-16-6-5-14(10-17(16)28-2)21(27)25-24-11-13-8-15(22)20(18(9-13)29-3)31-12-19(23)26/h5-6,8-11H,4,7,12H2,1-3H3,(H2,23,26)(H,25,27)/b24-11+ |
| InChIKey | VLTNYDZLPJTOCM-BHGWPJFGSA-N |
| XLogP | 2.77 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|