C25H24Cl2N2O7S — CID 126337133
[2-chloro-6-methoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126337133) has the molecular formula C25H24Cl2N2O7S and a molecular weight of 567.45 g/mol. Its IUPAC name is [2-chloro-6-methoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-6-methoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126337133 |
| Molecular Formula | C25H24Cl2N2O7S |
| Molecular Weight | 567.45 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | [2-chloro-6-methoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OS(=O)(=O)c3ccc(Cl)cc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H24Cl2N2O7S/c1-4-11-35-21-10-5-17(14-22(21)33-2)25(30)29-28-15-16-12-20(27)24(23(13-16)34-3)36-37(31,32)19-8-6-18(26)7-9-19/h5-10,12-15H,4,11H2,1-3H3,(H,29,30)/b28-15+ |
| InChIKey | CBDAZKRDAUUFPO-RWPZCVJISA-N |
| XLogP | 5.33 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|