C25H24Cl2N2O6S — CID 126318084
[2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126318084) has the molecular formula C25H24Cl2N2O6S and a molecular weight of 551.45 g/mol. Its IUPAC name is [2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126318084 |
| Molecular Formula | C25H24Cl2N2O6S |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | [2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2ccc(OS(=O)(=O)c3ccc(Cl)cc3)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C25H24Cl2N2O6S/c1-3-13-34-23-12-6-18(15-24(23)33-4-2)25(30)29-28-16-17-5-11-22(21(27)14-17)35-36(31,32)20-9-7-19(26)8-10-20/h5-12,14-16H,3-4,13H2,1-2H3,(H,29,30)/b28-16+ |
| InChIKey | INBRWWQQJFKEQA-LQKURTRISA-N |
| XLogP | 5.71 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|