C24H21Br2ClN2O6S — CID 126325574
[2,6-dibromo-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126325574) has the molecular formula C24H21Br2ClN2O6S and a molecular weight of 660.77 g/mol. Its IUPAC name is [2,6-dibromo-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,6-dibromo-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126325574 |
| Molecular Formula | C24H21Br2ClN2O6S |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 657.92 |
| IUPAC Name | [2,6-dibromo-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OS(=O)(=O)c3ccc(Cl)cc3)c(Br)c2)cc1OC |
| InChI | InChI=1S/C24H21Br2ClN2O6S/c1-3-10-34-21-9-4-16(13-22(21)33-2)24(30)29-28-14-15-11-19(25)23(20(26)12-15)35-36(31,32)18-7-5-17(27)6-8-18/h4-9,11-14H,3,10H2,1-2H3,(H,29,30)/b28-14+ |
| InChIKey | GAUMZQVMKZSKAM-CCVNUDIWSA-N |
| XLogP | 6.19 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|