C27H26BrClN2O7S — CID 126317494
[2-bromo-6-ethoxy-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126317494) has the molecular formula C27H26BrClN2O7S and a molecular weight of 637.94 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-6-ethoxy-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126317494 |
| Molecular Formula | C27H26BrClN2O7S |
| Molecular Weight | 637.94 g/mol |
| Exact Mass | 636.03 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OS(=O)(=O)c3ccc(Cl)cc3)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C27H26BrClN2O7S/c1-4-13-37-23-12-7-19(16-24(23)35-5-2)27(32)31-30-17-18-14-22(28)26(25(15-18)36-6-3)38-39(33,34)21-10-8-20(29)9-11-21/h4,7-12,14-17H,1,5-6,13H2,2-3H3,(H,31,32)/b30-17+ |
| InChIKey | ZIYSBOJEUNNGKA-OCSSWDANSA-N |
| XLogP | 6.00 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.94 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|