C26H25ClN2O7S — CID 126329774
[2-chloro-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenyl] benzenesulfonate (PubChem CID 126329774) has the molecular formula C26H25ClN2O7S and a molecular weight of 545.01 g/mol. Its IUPAC name is [2-chloro-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenyl] benzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126329774 |
| Molecular Formula | C26H25ClN2O7S |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | [2-chloro-4-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenyl] benzenesulfonate |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OS(=O)(=O)c3ccccc3)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C26H25ClN2O7S/c1-4-13-35-22-12-11-19(16-23(22)34-5-2)26(30)29-28-17-18-14-21(27)25(24(15-18)33-3)36-37(31,32)20-9-7-6-8-10-20/h4,6-12,14-17H,1,5,13H2,2-3H3,(H,29,30)/b28-17+ |
| InChIKey | OQZRAKPWZIBXHW-OGLMXYFKSA-N |
| XLogP | 4.84 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|