C24H20Cl2N2O6S — CID 126342555
[2,6-dichloro-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126342555) has the molecular formula C24H20Cl2N2O6S and a molecular weight of 535.41 g/mol. Its IUPAC name is [2,6-dichloro-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2,6-dichloro-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126342555 |
| Molecular Formula | C24H20Cl2N2O6S |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | [2,6-dichloro-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OS(=O)(=O)c3ccccc3)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C24H20Cl2N2O6S/c1-3-11-33-21-10-9-17(14-22(21)32-2)24(29)28-27-15-16-12-19(25)23(20(26)13-16)34-35(30,31)18-7-5-4-6-8-18/h3-10,12-15H,1,11H2,2H3,(H,28,29)/b27-15+ |
| InChIKey | SHFHANPYHGLRFJ-JFLMPSFJSA-N |
| XLogP | 5.10 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|