C21H23ClN2O5 — CID 126324368
N-[(E)-(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126324368) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126324368 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | C=CCOc1c(Cl)cc(/C=N/NC(=O)c2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H23ClN2O5/c1-5-9-29-20-16(22)10-14(11-19(20)28-6-2)13-23-24-21(25)15-7-8-17(26-3)18(12-15)27-4/h5,7-8,10-13H,1,6,9H2,2-4H3,(H,24,25)/b23-13+ |
| InChIKey | XSWXKGKTRBATKY-YDZHTSKRSA-N |
| XLogP | 4.08 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|