C27H27ClN2O5 — CID 126312281
N-[(E)-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 126312281) has the molecular formula C27H27ClN2O5 and a molecular weight of 494.98 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126312281 |
| Molecular Formula | C27H27ClN2O5 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-[(E)-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCc3ccc(C)cc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H27ClN2O5/c1-5-12-34-23-11-10-21(15-24(23)32-3)27(31)30-29-16-20-13-22(28)26(25(14-20)33-4)35-17-19-8-6-18(2)7-9-19/h5-11,13-16H,1,12,17H2,2-4H3,(H,30,31)/b29-16+ |
| InChIKey | YNGHMNRKZKWAFH-MUFRIFMGSA-N |
| XLogP | 5.57 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|