C27H25IN2O7 — CID 126308618
4-[[2-iodo-6-methoxy-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126308618) has the molecular formula C27H25IN2O7 and a molecular weight of 616.41 g/mol. Its IUPAC name is 4-[[2-iodo-6-methoxy-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-iodo-6-methoxy-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126308618 |
| Molecular Formula | C27H25IN2O7 |
| Molecular Weight | 616.41 g/mol |
| Exact Mass | 616.07 |
| IUPAC Name | 4-[[2-iodo-6-methoxy-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(I)c(OCc3ccc(C(=O)O)cc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H25IN2O7/c1-4-11-36-22-10-9-20(14-23(22)34-2)26(31)30-29-15-18-12-21(28)25(24(13-18)35-3)37-16-17-5-7-19(8-6-17)27(32)33/h4-10,12-15H,1,11,16H2,2-3H3,(H,30,31)(H,32,33)/b29-15+ |
| InChIKey | IVJMURFEYCVGHE-WKULSOCRSA-N |
| XLogP | 4.91 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|