C27H26IN3O7 — CID 126321478
3-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide (PubChem CID 126321478) has the molecular formula C27H26IN3O7 and a molecular weight of 631.42 g/mol. Its IUPAC name is 3-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide.
| Compound Name | 3-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126321478 |
| Molecular Formula | C27H26IN3O7 |
| Molecular Weight | 631.42 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | 3-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C27H26IN3O7/c1-4-12-37-23-11-8-20(15-24(23)36-5-2)27(32)30-29-16-19-13-22(28)26(25(14-19)35-3)38-17-18-6-9-21(10-7-18)31(33)34/h4,6-11,13-16H,1,5,12,17H2,2-3H3,(H,30,32)/b29-16+ |
| InChIKey | IWNOSZJCDBZOMZ-MUFRIFMGSA-N |
| XLogP | 5.51 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|