C28H28BrN3O7 — CID 126333114
N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide (PubChem CID 126333114) has the molecular formula C28H28BrN3O7 and a molecular weight of 598.45 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126333114 |
| Molecular Formula | C28H28BrN3O7 |
| Molecular Weight | 598.45 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCc3ccc([N+](=O)[O-])cc3)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C28H28BrN3O7/c1-4-13-38-24-12-9-21(16-25(24)36-5-2)28(33)31-30-17-20-14-23(29)27(26(15-20)37-6-3)39-18-19-7-10-22(11-8-19)32(34)35/h4,7-12,14-17H,1,5-6,13,18H2,2-3H3,(H,31,33)/b30-17+ |
| InChIKey | PGHDTJJETVHWDI-OCSSWDANSA-N |
| XLogP | 6.06 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|