C26H26BrN3O5 — CID 126370960
N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide (PubChem CID 126370960) has the molecular formula C26H26BrN3O5 and a molecular weight of 540.41 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126370960 |
| Molecular Formula | C26H26BrN3O5 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(CC)cc2)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H26BrN3O5/c1-3-18-5-7-19(8-6-18)15-25(31)29-28-16-21-13-23(27)26(24(14-21)34-4-2)35-17-20-9-11-22(12-10-20)30(32)33/h5-14,16H,3-4,15,17H2,1-2H3,(H,29,31)/b28-16+ |
| InChIKey | ZOWISWVCWOICKN-LQKURTRISA-N |
| XLogP | 5.59 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|