C24H21Br2N3O5 — CID 98050578
N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-bromophenyl)acetamide (PubChem CID 98050578) has the molecular formula C24H21Br2N3O5 and a molecular weight of 591.26 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-bromophenyl)acetamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 98050578 |
| Molecular Formula | C24H21Br2N3O5 |
| Molecular Weight | 591.26 g/mol |
| Exact Mass | 588.98 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-bromophenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(Br)cc2)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21Br2N3O5/c1-2-33-22-12-18(14-27-28-23(30)13-16-3-7-19(25)8-4-16)11-21(26)24(22)34-15-17-5-9-20(10-6-17)29(31)32/h3-12,14H,2,13,15H2,1H3,(H,28,30)/b27-14+ |
| InChIKey | IOTRTVOEPKHYLC-MZJWZYIUSA-N |
| XLogP | 5.79 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.26 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|