C25H24BrN3O5 — CID 126367562
N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide (PubChem CID 126367562) has the molecular formula C25H24BrN3O5 and a molecular weight of 526.39 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126367562 |
| Molecular Formula | C25H24BrN3O5 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(C)cc2)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H24BrN3O5/c1-3-33-23-13-20(15-27-28-24(30)14-18-6-4-17(2)5-7-18)12-22(26)25(23)34-16-19-8-10-21(11-9-19)29(31)32/h4-13,15H,3,14,16H2,1-2H3,(H,28,30)/b27-15+ |
| InChIKey | SJDHCMDAPAKKMY-JFLMPSFJSA-N |
| XLogP | 5.34 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|