C29H27BrN2O3 — CID 126369937
N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-methylphenyl)acetamide (PubChem CID 126369937) has the molecular formula C29H27BrN2O3 and a molecular weight of 531.45 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126369937 |
| Molecular Formula | C29H27BrN2O3 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(C)cc2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H27BrN2O3/c1-3-34-27-16-22(18-31-32-28(33)17-21-13-11-20(2)12-14-21)15-26(30)29(27)35-19-24-9-6-8-23-7-4-5-10-25(23)24/h4-16,18H,3,17,19H2,1-2H3,(H,32,33)/b31-18+ |
| InChIKey | ZDKQGTKXASFWAK-FDAWAROLSA-N |
| XLogP | 6.58 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|