C28H24Br2N2O2 — CID 99944609
N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 99944609) has the molecular formula C28H24Br2N2O2 and a molecular weight of 580.32 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 99944609 |
| Molecular Formula | C28H24Br2N2O2 |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2cc(Br)c(OCc3cccc4ccccc34)c(Br)c2)c(C)c1 |
| InChI | InChI=1S/C28H24Br2N2O2/c1-18-10-11-22(19(2)12-18)15-27(33)32-31-16-20-13-25(29)28(26(30)14-20)34-17-23-8-5-7-21-6-3-4-9-24(21)23/h3-14,16H,15,17H2,1-2H3,(H,32,33)/b31-16+ |
| InChIKey | OMDLRXJVYXOTPT-WCMJOSRZSA-N |
| XLogP | 7.25 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|