C25H23BrCl2N2O3 — CID 99944656
N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 99944656) has the molecular formula C25H23BrCl2N2O3 and a molecular weight of 550.28 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 99944656 |
| Molecular Formula | C25H23BrCl2N2O3 |
| Molecular Weight | 550.28 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2ccc(C)cc2C)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H23BrCl2N2O3/c1-15-4-5-18(16(2)8-15)11-24(31)30-29-13-17-9-21(26)25(23(10-17)32-3)33-14-19-6-7-20(27)12-22(19)28/h4-10,12-13H,11,14H2,1-3H3,(H,30,31)/b29-13+ |
| InChIKey | QJIQNOGMMRXONE-VFLNYLIXSA-N |
| XLogP | 6.65 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.28 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|