C26H24BrCl2N3O5 — CID 5023320
N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)butanediamide (PubChem CID 5023320) has the molecular formula C26H24BrCl2N3O5 and a molecular weight of 609.30 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)butanediamide.
| Compound Name | N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 5023320 |
| Molecular Formula | C26H24BrCl2N3O5 |
| Molecular Weight | 609.30 g/mol |
| Exact Mass | 607.03 |
| IUPAC Name | N'-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)butanediamide |
| SMILES | COc1ccc(NC(=O)CCC(=O)NN=Cc2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H24BrCl2N3O5/c1-35-20-7-5-19(6-8-20)31-24(33)9-10-25(34)32-30-14-16-11-21(27)26(23(12-16)36-2)37-15-17-3-4-18(28)13-22(17)29/h3-8,11-14H,9-10,15H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | BSULLXTXRVLDDL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.30 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|