C24H20BrCl2N3O4 — CID 126373687
3-acetamido-N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide (PubChem CID 126373687) has the molecular formula C24H20BrCl2N3O4 and a molecular weight of 565.25 g/mol. Its IUPAC name is 3-acetamido-N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 3-acetamido-N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126373687 |
| Molecular Formula | C24H20BrCl2N3O4 |
| Molecular Weight | 565.25 g/mol |
| Exact Mass | 563.00 |
| IUPAC Name | 3-acetamido-N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cccc(NC(C)=O)c2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20BrCl2N3O4/c1-14(31)29-19-5-3-4-16(10-19)24(32)30-28-12-15-8-20(25)23(22(9-15)33-2)34-13-17-6-7-18(26)11-21(17)27/h3-12H,13H2,1-2H3,(H,29,31)(H,30,32)/b28-12- |
| InChIKey | YWDKDVFPUJPMQP-NVJOKUIPSA-N |
| XLogP | 6.07 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.25 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|