C21H17BrClN3O3 — CID 4234102
N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 4234102) has the molecular formula C21H17BrClN3O3 and a molecular weight of 474.74 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 4234102 |
| Molecular Formula | C21H17BrClN3O3 |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccncc2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H17BrClN3O3/c1-28-19-11-14(12-25-26-21(27)15-6-8-24-9-7-15)10-17(22)20(19)29-13-16-4-2-3-5-18(16)23/h2-12H,13H2,1H3,(H,26,27) |
| InChIKey | BBYYKLADICAMFP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|