C16H14BrN3O5 — CID 5152075
2-[2-bromo-6-methoxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]acetic acid (PubChem CID 5152075) has the molecular formula C16H14BrN3O5 and a molecular weight of 408.21 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 5152075 |
| Molecular Formula | C16H14BrN3O5 |
| Molecular Weight | 408.21 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]acetic acid |
| SMILES | COc1cc(C=NNC(=O)c2ccncc2)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C16H14BrN3O5/c1-24-13-7-10(6-12(17)15(13)25-9-14(21)22)8-19-20-16(23)11-2-4-18-5-3-11/h2-8H,9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | KDDFTTZVGGNUBU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|