C16H13BrClN3O5 — CID 3950400
2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 3950400) has the molecular formula C16H13BrClN3O5 and a molecular weight of 442.65 g/mol. Its IUPAC name is 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 3950400 |
| Molecular Formula | C16H13BrClN3O5 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=NNC(=O)c2cccnc2Cl)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C16H13BrClN3O5/c1-25-12-6-9(5-11(17)14(12)26-8-13(22)23)7-20-21-16(24)10-3-2-4-19-15(10)18/h2-7H,8H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | BLMGSBUMLVKTJK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|