C16H13BrClN3O4 — CID 3445415
methyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3445415) has the molecular formula C16H13BrClN3O4 and a molecular weight of 426.65 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3445415 |
| Molecular Formula | C16H13BrClN3O4 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | methyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=NNC(=O)c2cccnc2Cl)cc1Br |
| InChI | InChI=1S/C16H13BrClN3O4/c1-24-14(22)9-25-13-5-4-10(7-12(13)17)8-20-21-16(23)11-3-2-6-19-15(11)18/h2-8H,9H2,1H3,(H,21,23) |
| InChIKey | WVHRFTKOPNZDBT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|