C17H17BrClN3O3 — CID 3948265
N-[(5-bromo-2,4-diethoxyphenyl)methylideneamino]-2-chloropyridine-3-carboxamide (PubChem CID 3948265) has the molecular formula C17H17BrClN3O3 and a molecular weight of 426.70 g/mol. Its IUPAC name is N-[(5-bromo-2,4-diethoxyphenyl)methylideneamino]-2-chloropyridine-3-carboxamide.
| Compound Name | N-[(5-bromo-2,4-diethoxyphenyl)methylideneamino]-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 3948265 |
| Molecular Formula | C17H17BrClN3O3 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | N-[(5-bromo-2,4-diethoxyphenyl)methylideneamino]-2-chloropyridine-3-carboxamide |
| SMILES | CCOc1cc(OCC)c(C=NNC(=O)c2cccnc2Cl)cc1Br |
| InChI | InChI=1S/C17H17BrClN3O3/c1-3-24-14-9-15(25-4-2)13(18)8-11(14)10-21-22-17(23)12-6-5-7-20-16(12)19/h5-10H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | AOSIZZOJYWFKHI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|