C17H18ClN3O3 — CID 3933448
2-chloro-N-[(2,4-diethoxyphenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 3933448) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-diethoxyphenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(2,4-diethoxyphenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3933448 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-chloro-N-[(2,4-diethoxyphenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | CCOc1ccc(C=NNC(=O)c2cccnc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-3-23-13-8-7-12(15(10-13)24-4-2)11-20-21-17(22)14-6-5-9-19-16(14)18/h5-11H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | PWDRKMOYRASNCH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|