C18H18ClN3O5 — CID 3513981
methyl 2-[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate (PubChem CID 3513981) has the molecular formula C18H18ClN3O5 and a molecular weight of 391.81 g/mol. Its IUPAC name is methyl 2-[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3513981 |
| Molecular Formula | C18H18ClN3O5 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | methyl 2-[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=NNC(=O)c2cccnc2Cl)ccc1OCC(=O)OC |
| InChI | InChI=1S/C18H18ClN3O5/c1-3-26-15-9-12(6-7-14(15)27-11-16(23)25-2)10-21-22-18(24)13-5-4-8-20-17(13)19/h4-10H,3,11H2,1-2H3,(H,22,24) |
| InChIKey | QRFPDHBOXDKNQF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|