C18H17BrClN3O5 — CID 3425465
ethyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 3425465) has the molecular formula C18H17BrClN3O5 and a molecular weight of 470.71 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3425465 |
| Molecular Formula | C18H17BrClN3O5 |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | ethyl 2-[2-bromo-4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NNC(=O)c2cccnc2Cl)cc1OC |
| InChI | InChI=1S/C18H17BrClN3O5/c1-3-27-15(24)10-28-16-13(19)7-11(8-14(16)26-2)9-22-23-18(25)12-5-4-6-21-17(12)20/h4-9H,3,10H2,1-2H3,(H,23,25) |
| InChIKey | LDQRKPWAFAFITF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|