C23H22BrN3O6 — CID 126029459
ethyl 2-[2-bromo-6-methoxy-4-[(E)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126029459) has the molecular formula C23H22BrN3O6 and a molecular weight of 516.35 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-methoxy-4-[(E)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-methoxy-4-[(E)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126029459 |
| Molecular Formula | C23H22BrN3O6 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | ethyl 2-[2-bromo-6-methoxy-4-[(E)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=N/NC(=O)COc2cccc3cccnc23)cc1OC |
| InChI | InChI=1S/C23H22BrN3O6/c1-3-31-21(29)14-33-23-17(24)10-15(11-19(23)30-2)12-26-27-20(28)13-32-18-8-4-6-16-7-5-9-25-22(16)18/h4-12H,3,13-14H2,1-2H3,(H,27,28)/b26-12+ |
| InChIKey | VIYHXCSLAOXEFH-RPPGKUMJSA-N |
| XLogP | 3.48 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|