C23H26BrN3O6 — CID 3966983
ethyl 2-[2-bromo-4-[[[3-(2-ethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 3966983) has the molecular formula C23H26BrN3O6 and a molecular weight of 520.38 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[[[3-(2-ethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[[[3-(2-ethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3966983 |
| Molecular Formula | C23H26BrN3O6 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | ethyl 2-[2-bromo-4-[[[3-(2-ethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NNC(=O)CC(=O)Nc2ccccc2CC)cc1OC |
| InChI | InChI=1S/C23H26BrN3O6/c1-4-16-8-6-7-9-18(16)26-20(28)12-21(29)27-25-13-15-10-17(24)23(19(11-15)31-3)33-14-22(30)32-5-2/h6-11,13H,4-5,12,14H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | XNJANQGQGYGBRE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|