C22H27N3O4 — CID 3643210
N-(2-ethylphenyl)-N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]propanediamide (PubChem CID 3643210) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N-(2-ethylphenyl)-N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3643210 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-(2-ethylphenyl)-N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]propanediamide |
| SMILES | CCCOc1ccc(C=NNC(=O)CC(=O)Nc2ccccc2CC)cc1OC |
| InChI | InChI=1S/C22H27N3O4/c1-4-12-29-19-11-10-16(13-20(19)28-3)15-23-25-22(27)14-21(26)24-18-9-7-6-8-17(18)5-2/h6-11,13,15H,4-5,12,14H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | SJXVOKJLZYBLCK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|