C31H31N3O4 — CID 4519852
N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-ethylphenyl)propanediamide (PubChem CID 4519852) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-ethylphenyl)propanediamide.
| Compound Name | N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-ethylphenyl)propanediamide |
|---|---|
| PubChem CID | 4519852 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-ethylphenyl)propanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CC(=O)Nc2ccccc2CC)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H31N3O4/c1-3-23-10-6-8-15-27(23)33-30(35)19-31(36)34-32-20-22-16-17-28(29(18-22)37-4-2)38-21-25-13-9-12-24-11-5-7-14-26(24)25/h5-18,20H,3-4,19,21H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | KHPMPRFZGVLDEZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|