C30H28FN3O4 — CID 4538002
N-[3-[2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide (PubChem CID 4538002) has the molecular formula C30H28FN3O4 and a molecular weight of 513.57 g/mol. Its IUPAC name is N-[3-[2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide.
| Compound Name | N-[3-[2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4538002 |
| Molecular Formula | C30H28FN3O4 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-[3-[2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)CCNC(=O)c2ccccc2F)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H28FN3O4/c1-2-37-28-18-21(14-15-27(28)38-20-23-10-7-9-22-8-3-4-11-24(22)23)19-33-34-29(35)16-17-32-30(36)25-12-5-6-13-26(25)31/h3-15,18-19H,2,16-17,20H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | ALBIXFVPDRILGA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|