C26H25FN4O6 — CID 4571378
N-[3-[2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide (PubChem CID 4571378) has the molecular formula C26H25FN4O6 and a molecular weight of 508.51 g/mol. Its IUPAC name is N-[3-[2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide.
| Compound Name | N-[3-[2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4571378 |
| Molecular Formula | C26H25FN4O6 |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[3-[2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]-2-fluorobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)CCNC(=O)c2ccccc2F)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25FN4O6/c1-2-36-24-15-19(9-12-23(24)37-17-18-7-10-20(11-8-18)31(34)35)16-29-30-25(32)13-14-28-26(33)21-5-3-4-6-22(21)27/h3-12,15-16H,2,13-14,17H2,1H3,(H,28,33)(H,30,32) |
| InChIKey | ADQZGYMXTAUBSN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|