C23H20N4O8 — CID 3367862
N-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide (PubChem CID 3367862) has the molecular formula C23H20N4O8 and a molecular weight of 480.43 g/mol. Its IUPAC name is N-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide.
| Compound Name | N-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 3367862 |
| Molecular Formula | C23H20N4O8 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)c2cc([N+](=O)[O-])ccc2O)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20N4O8/c1-2-34-22-11-16(5-10-21(22)35-14-15-3-6-17(7-4-15)26(30)31)13-24-25-23(29)19-12-18(27(32)33)8-9-20(19)28/h3-13,28H,2,14H2,1H3,(H,25,29) |
| InChIKey | XLNZJDNCNCKVHP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|