C27H28N4O7 — CID 4527998
N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)propanediamide (PubChem CID 4527998) has the molecular formula C27H28N4O7 and a molecular weight of 520.54 g/mol. Its IUPAC name is N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)propanediamide.
| Compound Name | N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 4527998 |
| Molecular Formula | C27H28N4O7 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
| SMILES | CCOc1ccc(NC(=O)CC(=O)NN=Cc2ccc(OCc3ccc([N+](=O)[O-])cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C27H28N4O7/c1-3-36-23-12-8-21(9-13-23)29-26(32)16-27(33)30-28-17-20-7-14-24(25(15-20)37-4-2)38-18-19-5-10-22(11-6-19)31(34)35/h5-15,17H,3-4,16,18H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | WKVBOGPCRHCURQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|