C22H20FN3O4 — CID 96867531
N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline (PubChem CID 96867531) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 96867531 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline |
| SMILES | CCOc1cc(/C=N/Nc2ccc([N+](=O)[O-])cc2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H20FN3O4/c1-2-29-22-13-17(14-24-25-19-8-10-20(11-9-19)26(27)28)5-12-21(22)30-15-16-3-6-18(23)7-4-16/h3-14,25H,2,15H2,1H3/b24-14+ |
| InChIKey | FFPQPZUYZCJVHO-ZVHZXABRSA-N |
| XLogP | 5.16 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|