C24H24N2O4 — CID 126205917
1-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine (PubChem CID 126205917) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine.
| Compound Name | 1-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 126205917 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(CC)cc2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-3-18-5-10-21(11-6-18)25-16-20-9-14-23(24(15-20)29-4-2)30-17-19-7-12-22(13-8-19)26(27)28/h5-16H,3-4,17H2,1-2H3/b25-16+ |
| InChIKey | CQXWQOUOOYLUKQ-PCLIKHOPSA-N |
| XLogP | 5.89 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|