C21H16N2O7 — CID 50885590
3,4-bis[(4-nitrophenyl)methoxy]benzaldehyde (PubChem CID 50885590) has the molecular formula C21H16N2O7 and a molecular weight of 408.37 g/mol. Its IUPAC name is 3,4-bis[(4-nitrophenyl)methoxy]benzaldehyde.
| Compound Name | 3,4-bis[(4-nitrophenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 50885590 |
| Molecular Formula | C21H16N2O7 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3,4-bis[(4-nitrophenyl)methoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCc2ccc([N+](=O)[O-])cc2)c(OCc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C21H16N2O7/c24-12-17-5-10-20(29-13-15-1-6-18(7-2-15)22(25)26)21(11-17)30-14-16-3-8-19(9-4-16)23(27)28/h1-12H,13-14H2 |
| InChIKey | JGJOSJRMCZKUOY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|