C13H11NO5 — CID 139941851
4-[(4-nitrophenyl)methoxy]benzene-1,3-diol (PubChem CID 139941851) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-[(4-nitrophenyl)methoxy]benzene-1,3-diol.
| Compound Name | 4-[(4-nitrophenyl)methoxy]benzene-1,3-diol |
|---|---|
| PubChem CID | 139941851 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-[(4-nitrophenyl)methoxy]benzene-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(COc2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C13H11NO5/c15-11-5-6-13(12(16)7-11)19-8-9-1-3-10(4-2-9)14(17)18/h1-7,15-16H,8H2 |
| InChIKey | FHDHFNZWZBIELN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|