C20H20N2O7 — CID 6209773
(E)-2-acetamido-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 6209773) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is (E)-2-acetamido-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6209773 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (E)-2-acetamido-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C(/NC(C)=O)C(=O)O)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N2O7/c1-3-28-19-11-15(10-17(20(24)25)21-13(2)23)6-9-18(19)29-12-14-4-7-16(8-5-14)22(26)27/h4-11H,3,12H2,1-2H3,(H,21,23)(H,24,25)/b17-10+ |
| InChIKey | RSNJSFPSWCBSKG-LICLKQGHSA-N |
| XLogP | 3.13 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|