C18H14Br2N2O6 — CID 6388664
(E)-2-acetamido-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 6388664) has the molecular formula C18H14Br2N2O6 and a molecular weight of 514.13 g/mol. Its IUPAC name is (E)-2-acetamido-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6388664 |
| Molecular Formula | C18H14Br2N2O6 |
| Molecular Weight | 514.13 g/mol |
| Exact Mass | 511.92 |
| IUPAC Name | (E)-2-acetamido-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | CC(=O)N/C(=C/c1cc(Br)c(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C18H14Br2N2O6/c1-10(23)21-16(18(24)25)8-12-6-14(19)17(15(20)7-12)28-9-11-2-4-13(5-3-11)22(26)27/h2-8H,9H2,1H3,(H,21,23)(H,24,25)/b16-8+ |
| InChIKey | VLPGILJYVLDGQH-LZYBPNLTSA-N |
| XLogP | 4.26 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.13 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|