C17H13BrClNO5 — CID 91685310
(E)-3-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoyl chloride (PubChem CID 91685310) has the molecular formula C17H13BrClNO5 and a molecular weight of 426.65 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoyl chloride.
| Compound Name | (E)-3-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoyl chloride |
|---|---|
| PubChem CID | 91685310 |
| Molecular Formula | C17H13BrClNO5 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | (E)-3-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoyl chloride |
| SMILES | COc1cc(/C=C/C(=O)Cl)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13BrClNO5/c1-24-15-9-12(4-7-16(19)21)8-14(18)17(15)25-10-11-2-5-13(6-3-11)20(22)23/h2-9H,10H2,1H3/b7-4+ |
| InChIKey | LKQHAEZHAGUTGX-QPJJXVBHSA-N |
| XLogP | 4.72 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|