C23H21BrN2O4 — CID 126217209
1-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylphenyl)methanimine (PubChem CID 126217209) has the molecular formula C23H21BrN2O4 and a molecular weight of 469.34 g/mol. Its IUPAC name is 1-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylphenyl)methanimine.
| Compound Name | 1-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126217209 |
| Molecular Formula | C23H21BrN2O4 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 1-[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cc(C)ccc2C)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21BrN2O4/c1-15-4-5-16(2)21(10-15)25-13-18-11-20(24)23(22(12-18)29-3)30-14-17-6-8-19(9-7-17)26(27)28/h4-13H,14H2,1-3H3/b25-13+ |
| InChIKey | LOMNPMKPZIYGKV-DHRITJCHSA-N |
| XLogP | 6.31 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|