C20H18BrNO8 — CID 1362538
dimethyl 2-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate (PubChem CID 1362538) has the molecular formula C20H18BrNO8 and a molecular weight of 480.27 g/mol. Its IUPAC name is dimethyl 2-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 1362538 |
| Molecular Formula | C20H18BrNO8 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | dimethyl 2-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1cc(Br)c(OCc2ccc([N+](=O)[O-])cc2)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C20H18BrNO8/c1-27-17-10-13(8-15(19(23)28-2)20(24)29-3)9-16(21)18(17)30-11-12-4-6-14(7-5-12)22(25)26/h4-10H,11H2,1-3H3 |
| InChIKey | FDZZXZBCROFRCA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|