C19H15Br2ClO5 — CID 126056672
dimethyl 2-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]propanedioate (PubChem CID 126056672) has the molecular formula C19H15Br2ClO5 and a molecular weight of 518.59 g/mol. Its IUPAC name is dimethyl 2-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 126056672 |
| Molecular Formula | C19H15Br2ClO5 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 515.90 |
| IUPAC Name | dimethyl 2-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1cc(Br)c(OCc2ccc(Cl)cc2)c(Br)c1)C(=O)OC |
| InChI | InChI=1S/C19H15Br2ClO5/c1-25-18(23)14(19(24)26-2)7-12-8-15(20)17(16(21)9-12)27-10-11-3-5-13(22)6-4-11/h3-9H,10H2,1-2H3 |
| InChIKey | SYVSEUBUJWAODY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|