C19H15Cl2NO7 — CID 126052607
dimethyl 2-[[3,5-dichloro-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate (PubChem CID 126052607) has the molecular formula C19H15Cl2NO7 and a molecular weight of 440.24 g/mol. Its IUPAC name is dimethyl 2-[[3,5-dichloro-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3,5-dichloro-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 126052607 |
| Molecular Formula | C19H15Cl2NO7 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | dimethyl 2-[[3,5-dichloro-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1cc(Cl)cc(Cl)c1OCc1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C19H15Cl2NO7/c1-27-18(23)15(19(24)28-2)8-12-7-13(20)9-16(21)17(12)29-10-11-3-5-14(6-4-11)22(25)26/h3-9H,10H2,1-2H3 |
| InChIKey | JCILEMOEDAQRSN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|