C18H13Cl3O7S — CID 126076542
dimethyl 2-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]propanedioate (PubChem CID 126076542) has the molecular formula C18H13Cl3O7S and a molecular weight of 479.72 g/mol. Its IUPAC name is dimethyl 2-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 126076542 |
| Molecular Formula | C18H13Cl3O7S |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 477.94 |
| IUPAC Name | dimethyl 2-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1cc(Cl)cc(Cl)c1OS(=O)(=O)c1ccc(Cl)cc1)C(=O)OC |
| InChI | InChI=1S/C18H13Cl3O7S/c1-26-17(22)14(18(23)27-2)8-10-7-12(20)9-15(21)16(10)28-29(24,25)13-5-3-11(19)4-6-13/h3-9H,1-2H3 |
| InChIKey | XVMVQTQDHIAUNK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|