C21H21ClO8S — CID 126071501
dimethyl 2-[[3-chloro-5-ethoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]propanedioate (PubChem CID 126071501) has the molecular formula C21H21ClO8S and a molecular weight of 468.91 g/mol. Its IUPAC name is dimethyl 2-[[3-chloro-5-ethoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3-chloro-5-ethoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 126071501 |
| Molecular Formula | C21H21ClO8S |
| Molecular Weight | 468.91 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | dimethyl 2-[[3-chloro-5-ethoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]propanedioate |
| SMILES | CCOc1cc(C=C(C(=O)OC)C(=O)OC)cc(Cl)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21ClO8S/c1-5-29-18-12-14(10-16(20(23)27-3)21(24)28-4)11-17(22)19(18)30-31(25,26)15-8-6-13(2)7-9-15/h6-12H,5H2,1-4H3 |
| InChIKey | HNWHZRNQJLZQLD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|